C13H19ClF2N2O3 — CID 119716002
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119716002) has the molecular formula C13H19ClF2N2O3 and a molecular weight of 324.76 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119716002 |
| Molecular Formula | C13H19ClF2N2O3 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCOc1cc(CNC(=O)CNC)ccc1OC(F)F.Cl |
| InChI | InChI=1S/C13H18F2N2O3.ClH/c1-3-19-11-6-9(7-17-12(18)8-16-2)4-5-10(11)20-13(14)15;/h4-6,13,16H,3,7-8H2,1-2H3,(H,17,18);1H |
| InChIKey | DMBHRLBNAYRFHX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |