C15H22F2N2O4 — CID 120588442
4-amino-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-methoxybutanamide (PubChem CID 120588442) has the molecular formula C15H22F2N2O4 and a molecular weight of 332.35 g/mol. Its IUPAC name is 4-amino-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120588442 |
| Molecular Formula | C15H22F2N2O4 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-amino-N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-3-methoxybutanamide |
| SMILES | CCOc1cc(CNC(=O)CC(CN)OC)ccc1OC(F)F |
| InChI | InChI=1S/C15H22F2N2O4/c1-3-22-13-6-10(4-5-12(13)23-15(16)17)9-19-14(20)7-11(8-18)21-2/h4-6,11,15H,3,7-9,18H2,1-2H3,(H,19,20) |
| InChIKey | ROJXOZNIZMYNKU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |