C18H19F2NO4 — CID 120509977
3-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]benzoic acid (PubChem CID 120509977) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is 3-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 120509977 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]methyl]benzoic acid |
| SMILES | CCOc1cc(CNCc2cccc(C(=O)O)c2)ccc1OC(F)F |
| InChI | InChI=1S/C18H19F2NO4/c1-2-24-16-9-13(6-7-15(16)25-18(19)20)11-21-10-12-4-3-5-14(8-12)17(22)23/h3-9,18,21H,2,10-11H2,1H3,(H,22,23) |
| InChIKey | BVUDAWSZYJMPDI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |