C15H17F2NO3 — CID 16770566
1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(furan-2-ylmethyl)methanamine (PubChem CID 16770566) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(furan-2-ylmethyl)methanamine.
| Compound Name | 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(furan-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 16770566 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(furan-2-ylmethyl)methanamine |
| SMILES | CCOc1cc(CNCc2ccco2)ccc1OC(F)F |
| InChI | InChI=1S/C15H17F2NO3/c1-2-19-14-8-11(5-6-13(14)21-15(16)17)9-18-10-12-4-3-7-20-12/h3-8,15,18H,2,9-10H2,1H3 |
| InChIKey | FFXNZYXYLDDPRZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |