C17H21NO7 — CID 171155021
1-(4-ethoxy-3-methoxyphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid (PubChem CID 171155021) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-(4-ethoxy-3-methoxyphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid.
| Compound Name | 1-(4-ethoxy-3-methoxyphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid |
|---|---|
| PubChem CID | 171155021 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(4-ethoxy-3-methoxyphenyl)-N-(furan-2-ylmethyl)methanamine;oxalic acid |
| SMILES | CCOc1ccc(CNCc2ccco2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H19NO3.C2H2O4/c1-3-18-14-7-6-12(9-15(14)17-2)10-16-11-13-5-4-8-19-13;3-1(4)2(5)6/h4-9,16H,3,10-11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OQWXMFAQHMJYTN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|