C18H21F2NO3 — CID 110902628
2-[4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]ethanol (PubChem CID 110902628) has the molecular formula C18H21F2NO3 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]ethanol.
| Compound Name | 2-[4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]ethanol |
|---|---|
| PubChem CID | 110902628 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[4-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]ethanol |
| SMILES | CCOc1cc(CNc2ccc(CCO)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H21F2NO3/c1-2-23-17-11-14(5-8-16(17)24-18(19)20)12-21-15-6-3-13(4-7-15)9-10-22/h3-8,11,18,21-22H,2,9-10,12H2,1H3 |
| InChIKey | KPOPWKJGTGZNEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |