C14H21F2NO3 — CID 78997784
3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]butan-1-ol (PubChem CID 78997784) has the molecular formula C14H21F2NO3 and a molecular weight of 289.32 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]butan-1-ol.
| Compound Name | 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 78997784 |
| Molecular Formula | C14H21F2NO3 |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]butan-1-ol |
| SMILES | CCOc1cc(CNC(C)CCO)ccc1OC(F)F |
| InChI | InChI=1S/C14H21F2NO3/c1-3-19-13-8-11(9-17-10(2)6-7-18)4-5-12(13)20-14(15)16/h4-5,8,10,14,17-18H,3,6-7,9H2,1-2H3 |
| InChIKey | LVNBGABSHYWORX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |