C14H18F2N2O2 — CID 62646901
3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]-2-methylpropanenitrile (PubChem CID 62646901) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]-2-methylpropanenitrile.
| Compound Name | 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 62646901 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]-2-methylpropanenitrile |
| SMILES | CCOc1cc(CNCC(C)C#N)ccc1OC(F)F |
| InChI | InChI=1S/C14H18F2N2O2/c1-3-19-13-6-11(9-18-8-10(2)7-17)4-5-12(13)20-14(15)16/h4-6,10,14,18H,3,8-9H2,1-2H3 |
| InChIKey | ZYBIUTVPIOQDNJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |