C16H18INO3 — CID 43344262
3-iodo-N-[(2,4,6-trimethoxyphenyl)methyl]aniline (PubChem CID 43344262) has the molecular formula C16H18INO3 and a molecular weight of 399.23 g/mol. Its IUPAC name is 3-iodo-N-[(2,4,6-trimethoxyphenyl)methyl]aniline.
| Compound Name | 3-iodo-N-[(2,4,6-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 43344262 |
| Molecular Formula | C16H18INO3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 3-iodo-N-[(2,4,6-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(OC)c(CNc2cccc(I)c2)c(OC)c1 |
| InChI | InChI=1S/C16H18INO3/c1-19-13-8-15(20-2)14(16(9-13)21-3)10-18-12-6-4-5-11(17)7-12/h4-9,18H,10H2,1-3H3 |
| InChIKey | SSCBLSNZBVAZSG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|