C12H13IN2O — CID 28879203
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-iodoaniline (PubChem CID 28879203) has the molecular formula C12H13IN2O and a molecular weight of 328.15 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-iodoaniline.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-iodoaniline |
|---|---|
| PubChem CID | 28879203 |
| Molecular Formula | C12H13IN2O |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-iodoaniline |
| SMILES | Cc1noc(C)c1CNc1cccc(I)c1 |
| InChI | InChI=1S/C12H13IN2O/c1-8-12(9(2)16-15-8)7-14-11-5-3-4-10(13)6-11/h3-6,14H,7H2,1-2H3 |
| InChIKey | MCJBNBCXAJNBMR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|