C12H12ClIN2O — CID 113254936
2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-iodoaniline (PubChem CID 113254936) has the molecular formula C12H12ClIN2O and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-iodoaniline.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-iodoaniline |
|---|---|
| PubChem CID | 113254936 |
| Molecular Formula | C12H12ClIN2O |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-iodoaniline |
| SMILES | Cc1noc(C)c1CNc1cc(I)ccc1Cl |
| InChI | InChI=1S/C12H12ClIN2O/c1-7-10(8(2)17-16-7)6-15-12-5-9(14)3-4-11(12)13/h3-5,15H,6H2,1-2H3 |
| InChIKey | VECVLPXZAGAFDS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|