C14H17ClN2O3 — CID 34068779
2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,5-dimethoxyaniline (PubChem CID 34068779) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,5-dimethoxyaniline.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 34068779 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4,5-dimethoxyaniline |
| SMILES | COc1cc(Cl)c(NCc2c(C)noc2C)cc1OC |
| InChI | InChI=1S/C14H17ClN2O3/c1-8-10(9(2)20-17-8)7-16-12-6-14(19-4)13(18-3)5-11(12)15/h5-6,16H,7H2,1-4H3 |
| InChIKey | FWKDYGMTTGSURT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|