C16H16N2O3 — CID 82534175
prop-2-ynyl 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzoate (PubChem CID 82534175) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is prop-2-ynyl 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzoate.
| Compound Name | prop-2-ynyl 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 82534175 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | prop-2-ynyl 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]benzoate |
| SMILES | C#CCOC(=O)c1cccc(NCc2c(C)noc2C)c1 |
| InChI | InChI=1S/C16H16N2O3/c1-4-8-20-16(19)13-6-5-7-14(9-13)17-10-15-11(2)18-21-12(15)3/h1,5-7,9,17H,8,10H2,2-3H3 |
| InChIKey | MYBYREWEUDZCCB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|