C15H15N3O — CID 43691291
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]quinolin-3-amine (PubChem CID 43691291) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]quinolin-3-amine.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]quinolin-3-amine |
|---|---|
| PubChem CID | 43691291 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]quinolin-3-amine |
| SMILES | Cc1noc(C)c1CNc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H15N3O/c1-10-14(11(2)19-18-10)9-16-13-7-12-5-3-4-6-15(12)17-8-13/h3-8,16H,9H2,1-2H3 |
| InChIKey | JBJCHKWHHOZHLA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |