C21H20N4O — CID 86791924
1,5-dimethyl-2-phenyl-4-[(quinolin-3-ylamino)methyl]pyrazol-3-one (PubChem CID 86791924) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-[(quinolin-3-ylamino)methyl]pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-[(quinolin-3-ylamino)methyl]pyrazol-3-one |
|---|---|
| PubChem CID | 86791924 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-[(quinolin-3-ylamino)methyl]pyrazol-3-one |
| SMILES | Cc1c(CNc2cnc3ccccc3c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H20N4O/c1-15-19(21(26)25(24(15)2)18-9-4-3-5-10-18)14-22-17-12-16-8-6-7-11-20(16)23-13-17/h3-13,22H,14H2,1-2H3 |
| InChIKey | YTMOJOXEWGZJPX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |