C11H14O6S — CID 18003765
2-[(3,5-dimethoxyphenyl)methylsulfonyl]acetic acid (PubChem CID 18003765) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyphenyl)methylsulfonyl]acetic acid.
| Compound Name | 2-[(3,5-dimethoxyphenyl)methylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 18003765 |
| Molecular Formula | C11H14O6S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-[(3,5-dimethoxyphenyl)methylsulfonyl]acetic acid |
| SMILES | COc1cc(CS(=O)(=O)CC(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C11H14O6S/c1-16-9-3-8(4-10(5-9)17-2)6-18(14,15)7-11(12)13/h3-5H,6-7H2,1-2H3,(H,12,13) |
| InChIKey | IGLREYWKSDXWCK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |