C18H23NO7S2 — CID 86705334
[4-[(2,4-dimethoxyphenyl)methylsulfamoylmethyl]phenyl]methyl methanesulfonate (PubChem CID 86705334) has the molecular formula C18H23NO7S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is [4-[(2,4-dimethoxyphenyl)methylsulfamoylmethyl]phenyl]methyl methanesulfonate.
| Compound Name | [4-[(2,4-dimethoxyphenyl)methylsulfamoylmethyl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86705334 |
| Molecular Formula | C18H23NO7S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [4-[(2,4-dimethoxyphenyl)methylsulfamoylmethyl]phenyl]methyl methanesulfonate |
| SMILES | COc1ccc(CNS(=O)(=O)Cc2ccc(COS(C)(=O)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H23NO7S2/c1-24-17-9-8-16(18(10-17)25-2)11-19-28(22,23)13-15-6-4-14(5-7-15)12-26-27(3,20)21/h4-10,19H,11-13H2,1-3H3 |
| InChIKey | RUKWDAMUTJHSRG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|