C23H21BrCl2N2O4 — CID 66542946
2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66542946) has the molecular formula C23H21BrCl2N2O4 and a molecular weight of 540.24 g/mol. Its IUPAC name is 2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66542946 |
| Molecular Formula | C23H21BrCl2N2O4 |
| Molecular Weight | 540.24 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | 2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(CNc2cc(Cl)c(O)c(Cl)c2)c(Br)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C23H21BrCl2N2O4/c1-13-3-5-15(6-4-13)28-22(29)12-32-21-10-17(24)14(7-20(21)31-2)11-27-16-8-18(25)23(30)19(26)9-16/h3-10,27,30H,11-12H2,1-2H3,(H,28,29) |
| InChIKey | XBXKWCMGPAWVAX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.24 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|