C20H23BrCl2N2O4 — CID 66544559
2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide (PubChem CID 66544559) has the molecular formula C20H23BrCl2N2O4 and a molecular weight of 506.22 g/mol. Its IUPAC name is 2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 66544559 |
| Molecular Formula | C20H23BrCl2N2O4 |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | 2-[5-bromo-4-[(3,5-dichloro-4-hydroxyanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
| SMILES | COc1cc(CNc2cc(Cl)c(O)c(Cl)c2)c(Br)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H23BrCl2N2O4/c1-20(2,3)25-18(26)10-29-17-8-13(21)11(5-16(17)28-4)9-24-12-6-14(22)19(27)15(23)7-12/h5-8,24,27H,9-10H2,1-4H3,(H,25,26) |
| InChIKey | CSKNZGUSOUIJKT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|