C18H29ClN2O3 — CID 66529720
N-tert-butyl-2-[4-[(tert-butylamino)methyl]-5-chloro-2-methoxyphenoxy]acetamide (PubChem CID 66529720) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(tert-butylamino)methyl]-5-chloro-2-methoxyphenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(tert-butylamino)methyl]-5-chloro-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 66529720 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-tert-butyl-2-[4-[(tert-butylamino)methyl]-5-chloro-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CNC(C)(C)C)c(Cl)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H29ClN2O3/c1-17(2,3)20-10-12-8-14(23-7)15(9-13(12)19)24-11-16(22)21-18(4,5)6/h8-9,20H,10-11H2,1-7H3,(H,21,22) |
| InChIKey | GCEYLJZLLZMVSL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |