C22H37ClN2O3 — CID 66529702
N-tert-butyl-2-[5-chloro-2-methoxy-4-[(octylamino)methyl]phenoxy]acetamide (PubChem CID 66529702) has the molecular formula C22H37ClN2O3 and a molecular weight of 413.00 g/mol. Its IUPAC name is N-tert-butyl-2-[5-chloro-2-methoxy-4-[(octylamino)methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[5-chloro-2-methoxy-4-[(octylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 66529702 |
| Molecular Formula | C22H37ClN2O3 |
| Molecular Weight | 413.00 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-tert-butyl-2-[5-chloro-2-methoxy-4-[(octylamino)methyl]phenoxy]acetamide |
| SMILES | CCCCCCCCNCc1cc(OC)c(OCC(=O)NC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C22H37ClN2O3/c1-6-7-8-9-10-11-12-24-15-17-13-19(27-5)20(14-18(17)23)28-16-21(26)25-22(2,3)4/h13-14,24H,6-12,15-16H2,1-5H3,(H,25,26) |
| InChIKey | DRJYUOZULAYRFA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.00 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|