C19H32ClN3O3 — CID 66537655
N-tert-butyl-2-[5-chloro-4-[[2-(dimethylamino)ethylamino]methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 66537655) has the molecular formula C19H32ClN3O3 and a molecular weight of 385.94 g/mol. Its IUPAC name is N-tert-butyl-2-[5-chloro-4-[[2-(dimethylamino)ethylamino]methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[5-chloro-4-[[2-(dimethylamino)ethylamino]methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 66537655 |
| Molecular Formula | C19H32ClN3O3 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N-tert-butyl-2-[5-chloro-4-[[2-(dimethylamino)ethylamino]methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(CNCCN(C)C)c(Cl)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H32ClN3O3/c1-7-25-16-10-14(12-21-8-9-23(5)6)15(20)11-17(16)26-13-18(24)22-19(2,3)4/h10-11,21H,7-9,12-13H2,1-6H3,(H,22,24) |
| InChIKey | QBTLGLJGDDRTDT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|