C25H37ClN2O3 — CID 66531389
2-[4-[(2-adamantylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-tert-butylacetamide (PubChem CID 66531389) has the molecular formula C25H37ClN2O3 and a molecular weight of 449.04 g/mol. Its IUPAC name is 2-[4-[(2-adamantylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[4-[(2-adamantylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 66531389 |
| Molecular Formula | C25H37ClN2O3 |
| Molecular Weight | 449.04 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[4-[(2-adamantylamino)methyl]-5-chloro-2-ethoxyphenoxy]-N-tert-butylacetamide |
| SMILES | CCOc1cc(CNC2C3CC4CC(C3)CC2C4)c(Cl)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H37ClN2O3/c1-5-30-21-11-19(20(26)12-22(21)31-14-23(29)28-25(2,3)4)13-27-24-17-7-15-6-16(9-17)10-18(24)8-15/h11-12,15-18,24,27H,5-10,13-14H2,1-4H3,(H,28,29) |
| InChIKey | PWSGBIZMUUZGLB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.04 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |