C22H30ClN3O4 — CID 66531361
N-tert-butyl-2-[5-chloro-2-ethoxy-4-[(2-pyridin-2-yloxyethylamino)methyl]phenoxy]acetamide (PubChem CID 66531361) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is N-tert-butyl-2-[5-chloro-2-ethoxy-4-[(2-pyridin-2-yloxyethylamino)methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[5-chloro-2-ethoxy-4-[(2-pyridin-2-yloxyethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 66531361 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-tert-butyl-2-[5-chloro-2-ethoxy-4-[(2-pyridin-2-yloxyethylamino)methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNCCOc2ccccn2)c(Cl)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H30ClN3O4/c1-5-28-18-12-16(14-24-10-11-29-21-8-6-7-9-25-21)17(23)13-19(18)30-15-20(27)26-22(2,3)4/h6-9,12-13,24H,5,10-11,14-15H2,1-4H3,(H,26,27) |
| InChIKey | OYWGWPVJZADOTP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|