C22H29Cl2NO2 — CID 66529148
N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine (PubChem CID 66529148) has the molecular formula C22H29Cl2NO2 and a molecular weight of 410.39 g/mol. Its IUPAC name is N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine.
| Compound Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine |
|---|---|
| PubChem CID | 66529148 |
| Molecular Formula | C22H29Cl2NO2 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1cc(OC)c(OCc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C22H29Cl2NO2/c1-3-4-5-6-7-12-25-15-18-13-21(26-2)22(14-20(18)24)27-16-17-8-10-19(23)11-9-17/h8-11,13-14,25H,3-7,12,15-16H2,1-2H3 |
| InChIKey | YLVSFVWIZXAPGI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|