C18H29BrN2O4 — CID 66535097
2-[5-bromo-2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]-N-tert-butylacetamide (PubChem CID 66535097) has the molecular formula C18H29BrN2O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[5-bromo-2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 66535097 |
| Molecular Formula | C18H29BrN2O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]-N-tert-butylacetamide |
| SMILES | COCCCNCc1cc(OC)c(OCC(=O)NC(C)(C)C)cc1Br |
| InChI | InChI=1S/C18H29BrN2O4/c1-18(2,3)21-17(22)12-25-16-10-14(19)13(9-15(16)24-5)11-20-7-6-8-23-4/h9-10,20H,6-8,11-12H2,1-5H3,(H,21,22) |
| InChIKey | AEEKPABOUDBJFY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|