C16H26BrClN2O3 — CID 17053956
2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-tert-butylacetamide;hydrochloride (PubChem CID 17053956) has the molecular formula C16H26BrClN2O3 and a molecular weight of 409.75 g/mol. Its IUPAC name is 2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-tert-butylacetamide;hydrochloride.
| Compound Name | 2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-tert-butylacetamide;hydrochloride |
|---|---|
| PubChem CID | 17053956 |
| Molecular Formula | C16H26BrClN2O3 |
| Molecular Weight | 409.75 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-tert-butylacetamide;hydrochloride |
| SMILES | COCCNCc1cc(Br)ccc1OCC(=O)NC(C)(C)C.Cl |
| InChI | InChI=1S/C16H25BrN2O3.ClH/c1-16(2,3)19-15(20)11-22-14-6-5-13(17)9-12(14)10-18-7-8-21-4;/h5-6,9,18H,7-8,10-11H2,1-4H3,(H,19,20);1H |
| InChIKey | WNLIJIAJPGHCBX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|