C17H28BrN3O3 — CID 17053945
2-[4-bromo-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]-N-tert-butylacetamide (PubChem CID 17053945) has the molecular formula C17H28BrN3O3 and a molecular weight of 402.33 g/mol. Its IUPAC name is 2-[4-bromo-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[4-bromo-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 17053945 |
| Molecular Formula | C17H28BrN3O3 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[4-bromo-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)COc1ccc(Br)cc1CNCCNCCO |
| InChI | InChI=1S/C17H28BrN3O3/c1-17(2,3)21-16(23)12-24-15-5-4-14(18)10-13(15)11-20-7-6-19-8-9-22/h4-5,10,19-20,22H,6-9,11-12H2,1-3H3,(H,21,23) |
| InChIKey | BFKBYOVADVNNLQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|