C17H31Cl2N3O3 — CID 17295535
N-tert-butyl-2-[4-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride (PubChem CID 17295535) has the molecular formula C17H31Cl2N3O3 and a molecular weight of 396.36 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride.
| Compound Name | N-tert-butyl-2-[4-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17295535 |
| Molecular Formula | C17H31Cl2N3O3 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-tert-butyl-2-[4-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride |
| SMILES | CC(C)(C)NC(=O)COc1ccc(CNCCNCCO)cc1.Cl.Cl |
| InChI | InChI=1S/C17H29N3O3.2ClH/c1-17(2,3)20-16(22)13-23-15-6-4-14(5-7-15)12-19-9-8-18-10-11-21;;/h4-7,18-19,21H,8-13H2,1-3H3,(H,20,22);2*1H |
| InChIKey | GAKATXOUIXHWFU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|