C19H32N2O3 — CID 17208957
N-tert-butyl-2-[4-[(3-propan-2-yloxypropylamino)methyl]phenoxy]acetamide (PubChem CID 17208957) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(3-propan-2-yloxypropylamino)methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(3-propan-2-yloxypropylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17208957 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | N-tert-butyl-2-[4-[(3-propan-2-yloxypropylamino)methyl]phenoxy]acetamide |
| SMILES | CC(C)OCCCNCc1ccc(OCC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O3/c1-15(2)23-12-6-11-20-13-16-7-9-17(10-8-16)24-14-18(22)21-19(3,4)5/h7-10,15,20H,6,11-14H2,1-5H3,(H,21,22) |
| InChIKey | FXNVOMPSUVTBKJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|