C18H33Cl2N3O2 — CID 17215561
N-tert-butyl-2-[4-[[3-(ethylamino)propylamino]methyl]phenoxy]acetamide;dihydrochloride (PubChem CID 17215561) has the molecular formula C18H33Cl2N3O2 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[3-(ethylamino)propylamino]methyl]phenoxy]acetamide;dihydrochloride.
| Compound Name | N-tert-butyl-2-[4-[[3-(ethylamino)propylamino]methyl]phenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17215561 |
| Molecular Formula | C18H33Cl2N3O2 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-tert-butyl-2-[4-[[3-(ethylamino)propylamino]methyl]phenoxy]acetamide;dihydrochloride |
| SMILES | CCNCCCNCc1ccc(OCC(=O)NC(C)(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C18H31N3O2.2ClH/c1-5-19-11-6-12-20-13-15-7-9-16(10-8-15)23-14-17(22)21-18(2,3)4;;/h7-10,19-20H,5-6,11-14H2,1-4H3,(H,21,22);2*1H |
| InChIKey | ZNYUHHGLUJKWBE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|