C15H24N2O3 — CID 82364486
N,N-diethyl-2-[4-[(2-hydroxyethylamino)methyl]phenoxy]acetamide (PubChem CID 82364486) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[(2-hydroxyethylamino)methyl]phenoxy]acetamide.
| Compound Name | N,N-diethyl-2-[4-[(2-hydroxyethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 82364486 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N,N-diethyl-2-[4-[(2-hydroxyethylamino)methyl]phenoxy]acetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(CNCCO)cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-17(4-2)15(19)12-20-14-7-5-13(6-8-14)11-16-9-10-18/h5-8,16,18H,3-4,9-12H2,1-2H3 |
| InChIKey | NNOYQZIBIVKZNY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|