C22H29BrN2O3 — CID 17053929
2-[4-bromo-2-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-tert-butylacetamide (PubChem CID 17053929) has the molecular formula C22H29BrN2O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is 2-[4-bromo-2-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[4-bromo-2-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 17053929 |
| Molecular Formula | C22H29BrN2O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-[4-bromo-2-[[2-(4-methoxyphenyl)ethylamino]methyl]phenoxy]-N-tert-butylacetamide |
| SMILES | COc1ccc(CCNCc2cc(Br)ccc2OCC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29BrN2O3/c1-22(2,3)25-21(26)15-28-20-10-7-18(23)13-17(20)14-24-12-11-16-5-8-19(27-4)9-6-16/h5-10,13,24H,11-12,14-15H2,1-4H3,(H,25,26) |
| InChIKey | RHZLBXYJQIOHLN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|