C23H24BrCl2NO2 — CID 17292866
N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17292866) has the molecular formula C23H24BrCl2NO2 and a molecular weight of 497.26 g/mol. Its IUPAC name is N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17292866 |
| Molecular Formula | C23H24BrCl2NO2 |
| Molecular Weight | 497.26 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | N-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2cc(Br)ccc2OCc2ccc(Cl)cc2)cc1.Cl |
| InChI | InChI=1S/C23H23BrClNO2.ClH/c1-27-22-9-4-17(5-10-22)12-13-26-15-19-14-20(24)6-11-23(19)28-16-18-2-7-21(25)8-3-18;/h2-11,14,26H,12-13,15-16H2,1H3;1H |
| InChIKey | BPGCHVQGKUSMRO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.26 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|