C21H26ClFN2O2 — CID 17054171
N-tert-butyl-2-[4-chloro-2-[[2-(4-fluorophenyl)ethylamino]methyl]phenoxy]acetamide (PubChem CID 17054171) has the molecular formula C21H26ClFN2O2 and a molecular weight of 392.90 g/mol. Its IUPAC name is N-tert-butyl-2-[4-chloro-2-[[2-(4-fluorophenyl)ethylamino]methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[4-chloro-2-[[2-(4-fluorophenyl)ethylamino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17054171 |
| Molecular Formula | C21H26ClFN2O2 |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-tert-butyl-2-[4-chloro-2-[[2-(4-fluorophenyl)ethylamino]methyl]phenoxy]acetamide |
| SMILES | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H26ClFN2O2/c1-21(2,3)25-20(26)14-27-19-9-6-17(22)12-16(19)13-24-11-10-15-4-7-18(23)8-5-15/h4-9,12,24H,10-11,13-14H2,1-3H3,(H,25,26) |
| InChIKey | NSCRHGSMBBXVBH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|