C20H26Cl2N2O2 — CID 17054094
2-[2-[(benzylamino)methyl]-4-chlorophenoxy]-N-tert-butylacetamide;hydrochloride (PubChem CID 17054094) has the molecular formula C20H26Cl2N2O2 and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-[2-[(benzylamino)methyl]-4-chlorophenoxy]-N-tert-butylacetamide;hydrochloride.
| Compound Name | 2-[2-[(benzylamino)methyl]-4-chlorophenoxy]-N-tert-butylacetamide;hydrochloride |
|---|---|
| PubChem CID | 17054094 |
| Molecular Formula | C20H26Cl2N2O2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[2-[(benzylamino)methyl]-4-chlorophenoxy]-N-tert-butylacetamide;hydrochloride |
| SMILES | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CNCc1ccccc1.Cl |
| InChI | InChI=1S/C20H25ClN2O2.ClH/c1-20(2,3)23-19(24)14-25-18-10-9-17(21)11-16(18)13-22-12-15-7-5-4-6-8-15;/h4-11,22H,12-14H2,1-3H3,(H,23,24);1H |
| InChIKey | ZMVKXPRXEGIMGD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |