C14H20ClN7O2 — CID 17057947
2-[2-[[(5-aminotetrazol-1-yl)amino]methyl]-4-chlorophenoxy]-N-tert-butylacetamide (PubChem CID 17057947) has the molecular formula C14H20ClN7O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is 2-[2-[[(5-aminotetrazol-1-yl)amino]methyl]-4-chlorophenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[2-[[(5-aminotetrazol-1-yl)amino]methyl]-4-chlorophenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 17057947 |
| Molecular Formula | C14H20ClN7O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[2-[[(5-aminotetrazol-1-yl)amino]methyl]-4-chlorophenoxy]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CNn1nnnc1N |
| InChI | InChI=1S/C14H20ClN7O2/c1-14(2,3)18-12(23)8-24-11-5-4-10(15)6-9(11)7-17-22-13(16)19-20-21-22/h4-6,17H,7-8H2,1-3H3,(H,18,23)(H2,16,19,21) |
| InChIKey | NNUCRYBAEMXDTI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |