C9H11ClN6O — CID 4725991
1-N-[(5-chloro-2-methoxyphenyl)methyl]tetrazole-1,5-diamine (PubChem CID 4725991) has the molecular formula C9H11ClN6O and a molecular weight of 254.68 g/mol. Its IUPAC name is 1-N-[(5-chloro-2-methoxyphenyl)methyl]tetrazole-1,5-diamine.
| Compound Name | 1-N-[(5-chloro-2-methoxyphenyl)methyl]tetrazole-1,5-diamine |
|---|---|
| PubChem CID | 4725991 |
| Molecular Formula | C9H11ClN6O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-N-[(5-chloro-2-methoxyphenyl)methyl]tetrazole-1,5-diamine |
| SMILES | COc1ccc(Cl)cc1CNn1nnnc1N |
| InChI | InChI=1S/C9H11ClN6O/c1-17-8-3-2-7(10)4-6(8)5-12-16-9(11)13-14-15-16/h2-4,12H,5H2,1H3,(H2,11,13,15) |
| InChIKey | HLNWCKLYEQMECN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |