C20H22Cl2N2O4 — CID 17058507
5-[[2-[2-(tert-butylamino)-2-oxoethoxy]-5-chlorophenyl]methylamino]-2-chlorobenzoic acid (PubChem CID 17058507) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is 5-[[2-[2-(tert-butylamino)-2-oxoethoxy]-5-chlorophenyl]methylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-[2-(tert-butylamino)-2-oxoethoxy]-5-chlorophenyl]methylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 17058507 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 5-[[2-[2-(tert-butylamino)-2-oxoethoxy]-5-chlorophenyl]methylamino]-2-chlorobenzoic acid |
| SMILES | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CNc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-20(2,3)24-18(25)11-28-17-7-4-13(21)8-12(17)10-23-14-5-6-16(22)15(9-14)19(26)27/h4-9,23H,10-11H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | UXZZJCVXSUSVTH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |