C20H23ClN2O4 — CID 17058497
5-[[2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]methylamino]-2-chlorobenzoic acid (PubChem CID 17058497) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 5-[[2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]methylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]methylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 17058497 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 5-[[2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]methylamino]-2-chlorobenzoic acid |
| SMILES | CC(C)(C)NC(=O)COc1ccccc1CNc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H23ClN2O4/c1-20(2,3)23-18(24)12-27-17-7-5-4-6-13(17)11-22-14-8-9-16(21)15(10-14)19(25)26/h4-10,22H,11-12H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | WKRRAVOZRHZWGD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |