C22H20Cl2N2O2 — CID 126212904
2-[2-[(3,4-dichloroanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126212904) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-[2-[(3,4-dichloroanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-[(3,4-dichloroanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126212904 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[2-[(3,4-dichloroanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccccc2CNc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H20Cl2N2O2/c1-15-5-4-7-18(11-15)26-22(27)14-28-21-8-3-2-6-16(21)13-25-17-9-10-19(23)20(24)12-17/h2-12,25H,13-14H2,1H3,(H,26,27) |
| InChIKey | VTLIGDUOQVPALT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |