C20H17ClN2O4 — CID 17058502
5-[[2-(2-amino-2-oxoethoxy)naphthalen-1-yl]methylamino]-2-chlorobenzoic acid (PubChem CID 17058502) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 5-[[2-(2-amino-2-oxoethoxy)naphthalen-1-yl]methylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-(2-amino-2-oxoethoxy)naphthalen-1-yl]methylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 17058502 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 5-[[2-(2-amino-2-oxoethoxy)naphthalen-1-yl]methylamino]-2-chlorobenzoic acid |
| SMILES | NC(=O)COc1ccc2ccccc2c1CNc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H17ClN2O4/c21-17-7-6-13(9-15(17)20(25)26)23-10-16-14-4-2-1-3-12(14)5-8-18(16)27-11-19(22)24/h1-9,23H,10-11H2,(H2,22,24)(H,25,26) |
| InChIKey | FWXSADRARASBDY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |