C26H22ClNO3 — CID 17058514
2-chloro-5-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylamino]benzoic acid (PubChem CID 17058514) has the molecular formula C26H22ClNO3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-chloro-5-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylamino]benzoic acid.
| Compound Name | 2-chloro-5-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 17058514 |
| Molecular Formula | C26H22ClNO3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-chloro-5-[[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylamino]benzoic acid |
| SMILES | Cc1ccc(COc2ccc3ccccc3c2CNc2ccc(Cl)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C26H22ClNO3/c1-17-6-8-18(9-7-17)16-31-25-13-10-19-4-2-3-5-21(19)23(25)15-28-20-11-12-24(27)22(14-20)26(29)30/h2-14,28H,15-16H2,1H3,(H,29,30) |
| InChIKey | OBSUBUYKFBUVLF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |