C20H18ClNO3 — CID 66527086
2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]acetic acid (PubChem CID 66527086) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]acetic acid.
| Compound Name | 2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]acetic acid |
|---|---|
| PubChem CID | 66527086 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]acetic acid |
| SMILES | O=C(O)CNCc1c(OCc2ccc(Cl)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C20H18ClNO3/c21-16-8-5-14(6-9-16)13-25-19-10-7-15-3-1-2-4-17(15)18(19)11-22-12-20(23)24/h1-10,22H,11-13H2,(H,23,24) |
| InChIKey | FSQDKSFNXZXHHY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |