C22H27Cl3N2O2 — CID 17294792
2-[2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethylamino]ethanol;dihydrochloride (PubChem CID 17294792) has the molecular formula C22H27Cl3N2O2 and a molecular weight of 457.83 g/mol. Its IUPAC name is 2-[2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethylamino]ethanol;dihydrochloride.
| Compound Name | 2-[2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17294792 |
| Molecular Formula | C22H27Cl3N2O2 |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[2-[[2-[(4-chlorophenyl)methoxy]naphthalen-1-yl]methylamino]ethylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCNCCNCc1c(OCc2ccc(Cl)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C22H25ClN2O2.2ClH/c23-19-8-5-17(6-9-19)16-27-22-10-7-18-3-1-2-4-20(18)21(22)15-25-12-11-24-13-14-26;;/h1-10,24-26H,11-16H2;2*1H |
| InChIKey | NACZSWATHFPCBK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|