C28H26N2O4 — CID 66539065
4-methyl-3-[[2-[2-(4-methylanilino)-2-oxoethoxy]naphthalen-1-yl]methylamino]benzoic acid (PubChem CID 66539065) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-methyl-3-[[2-[2-(4-methylanilino)-2-oxoethoxy]naphthalen-1-yl]methylamino]benzoic acid.
| Compound Name | 4-methyl-3-[[2-[2-(4-methylanilino)-2-oxoethoxy]naphthalen-1-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 66539065 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-methyl-3-[[2-[2-(4-methylanilino)-2-oxoethoxy]naphthalen-1-yl]methylamino]benzoic acid |
| SMILES | Cc1ccc(NC(=O)COc2ccc3ccccc3c2CNc2cc(C(=O)O)ccc2C)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-18-7-12-22(13-8-18)30-27(31)17-34-26-14-11-20-5-3-4-6-23(20)24(26)16-29-25-15-21(28(32)33)10-9-19(25)2/h3-15,29H,16-17H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | LNWWGOAEYXAEKW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |