C25H25ClN2O5 — CID 66539562
4-chloro-3-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid (PubChem CID 66539562) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is 4-chloro-3-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid.
| Compound Name | 4-chloro-3-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 66539562 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 4-chloro-3-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid |
| SMILES | CCOc1cc(CNc2cc(C(=O)O)ccc2Cl)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H25ClN2O5/c1-3-32-23-12-17(14-27-21-13-18(25(30)31)7-10-20(21)26)6-11-22(23)33-15-24(29)28-19-8-4-16(2)5-9-19/h4-13,27H,3,14-15H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | MWHRQEMPDQHZRB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |