C20H24N2O5 — CID 66528287
2-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]acetic acid (PubChem CID 66528287) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]acetic acid.
| Compound Name | 2-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 66528287 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]acetic acid |
| SMILES | CCOc1cc(CNCC(=O)O)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-3-26-18-10-15(11-21-12-20(24)25)6-9-17(18)27-13-19(23)22-16-7-4-14(2)5-8-16/h4-10,21H,3,11-13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | WJPGCGVXFZPKDE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |