C22H30Cl2N2O3 — CID 17208545
N-tert-butyl-2-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]acetamide;hydrochloride (PubChem CID 17208545) has the molecular formula C22H30Cl2N2O3 and a molecular weight of 441.40 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]acetamide;hydrochloride.
| Compound Name | N-tert-butyl-2-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17208545 |
| Molecular Formula | C22H30Cl2N2O3 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-tert-butyl-2-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]acetamide;hydrochloride |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2)ccc1OCC(=O)NC(C)(C)C.Cl |
| InChI | InChI=1S/C22H29ClN2O3.ClH/c1-22(2,3)25-21(26)15-28-19-10-7-17(13-20(19)27-4)14-24-12-11-16-5-8-18(23)9-6-16;/h5-10,13,24H,11-12,14-15H2,1-4H3,(H,25,26);1H |
| InChIKey | CVIIUJYDBPZRDI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|