C19H35Cl2N3O4 — CID 17295544
N-tert-butyl-2-[4-[[2-(2-hydroxypropylamino)ethylamino]methyl]-2-methoxyphenoxy]acetamide;dihydrochloride (PubChem CID 17295544) has the molecular formula C19H35Cl2N3O4 and a molecular weight of 440.41 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[2-(2-hydroxypropylamino)ethylamino]methyl]-2-methoxyphenoxy]acetamide;dihydrochloride.
| Compound Name | N-tert-butyl-2-[4-[[2-(2-hydroxypropylamino)ethylamino]methyl]-2-methoxyphenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17295544 |
| Molecular Formula | C19H35Cl2N3O4 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-tert-butyl-2-[4-[[2-(2-hydroxypropylamino)ethylamino]methyl]-2-methoxyphenoxy]acetamide;dihydrochloride |
| SMILES | COc1cc(CNCCNCC(C)O)ccc1OCC(=O)NC(C)(C)C.Cl.Cl |
| InChI | InChI=1S/C19H33N3O4.2ClH/c1-14(23)11-20-8-9-21-12-15-6-7-16(17(10-15)25-5)26-13-18(24)22-19(2,3)4;;/h6-7,10,14,20-21,23H,8-9,11-13H2,1-5H3,(H,22,24);2*1H |
| InChIKey | JOTJBZMJYOAEOG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|